![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/a.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ABAfinal.pdf | 2008-12-06 09:26 | 170K | |
| AIandSE.pdf | 2017-05-27 10:41 | 1.0M | |
| AI natural world.pdf | 2006-07-10 11:34 | 136K | |
| ALP-NAF.pdf | 2012-05-01 17:54 | 642K | |
| AbductiveLogicProgrammingSurvey.gz | 2000-09-01 16:58 | 114K | |
| BDKTarg.pdf | 2010-02-24 09:12 | 3.2M | |
| British Nationality Act.pdf | 2006-07-10 13:51 | 1.6M | |
| CLIMA XI.pdf | 2010-06-19 09:56 | 185K | |
| Chap1.html | 2003-10-07 10:48 | 61K | |
| Chap1.zip | 2002-03-10 13:54 | 20K | |
| Chap2.html | 2003-10-07 19:23 | 72K | |
| Chap2.zip | 2002-03-10 13:56 | 47K | |
| Chap2_files/ | 2003-10-07 14:58 | - | |
| Chap3.html | 2003-10-07 11:02 | 88K | |
| Chap3.zip | 2002-03-12 19:45 | 22K | |
| Chap4.html | 2003-10-07 12:54 | 87K | |
| Chap4.zip | 2002-03-12 19:46 | 18K | |
| Chap5.html | 2003-10-07 12:41 | 61K | |
| Chap8.html | 2003-11-25 12:35 | 78K | |
| Chap9.html | 2004-02-02 15:29 | 99K | |
| Chapter0.pdf | 2002-04-07 04:31 | 289K | |
| Chapter1.pdf | 2002-04-07 04:40 | 611K | |
| Chapter2.pdf | 2002-04-07 04:45 | 713K | |
| Chapter3.pdf | 2002-04-07 04:49 | 626K | |
| Chapter4.pdf | 2002-04-07 04:55 | 865K | |
| Chapter5.pdf | 2002-04-07 05:01 | 855K | |
| Chapter6.pdf | 2002-04-07 05:04 | 392K | |
| Chapter7.pdf | 2002-04-07 05:06 | 344K | |
| Chapter8.pdf | 2002-04-07 05:10 | 426K | |
| Chapter9.pdf | 2002-04-07 05:12 | 392K | |
| Chapter10.pdf | 2002-04-07 05:16 | 468K | |
| Chapter11.pdf | 2002-04-07 05:19 | 398K | |
| Chapter12.pdf | 2002-04-07 05:22 | 448K | |
| Chapter13.pdf | 2002-04-07 05:24 | 343K | |
| Combining LP and IP in LPS.pdf | 2023-04-12 16:42 | 620K | |
| Combining Prolog and Imperative Computing in LPS.pdf | 2022-09-08 09:30 | 278K | |
| Consciousness.html | 2003-10-07 13:50 | 62K | |
| David and Kowalski.pdf | 2022-11-14 17:37 | 37M | |
| Directions.zip | 2002-03-09 18:12 | 29K | |
| Editorial JLC 1993.pdf | 2015-11-07 08:36 | 161K | |
| English as LP language.pdf | 2020-07-30 12:10 | 247K | |
| FGCS1993.pdf | 2017-10-30 12:49 | 1.5M | |
| History.pdf | 2013-12-18 10:34 | 482K | |
| IFIP 74.pdf | 2007-07-02 12:22 | 1.4M | |
| IFIP74.pdf | 2006-07-17 16:46 | 1.4M | |
| IJCA2011.pdf | 2011-05-10 08:51 | 193K | |
| Index.pdf | 2002-04-07 05:38 | 288K | |
| Indian pension rules.pdf | 2023-12-12 13:25 | 710K | |
| InsurLE.pdf | 2025-02-04 13:20 | 1.2M | |
| KELPS 2015.pdf | 2015-11-14 11:19 | 440K | |
| KELPS Completeness.pdf | 2014-06-05 19:23 | 266K | |
| Kowalski-Kim.pdf | 2006-07-10 13:55 | 2.2M | |
| Kowalski-Mostowski.pdf | 2008-02-23 13:49 | 131K | |
| Kowalski PhD.pdf | 2015-04-04 08:42 | 4.0M | |
| LE LPOP 2020.pdf | 2020-11-11 18:57 | 123K | |
| LE_for_LA.pdf | 2021-10-29 19:31 | 615K | |
| LE for LA.pdf | 2021-10-29 19:31 | 615K | |
| LE meets LE.pdf | 2020-12-16 17:36 | 249K | |
| LFPScommentary.pdf | 2017-01-19 11:24 | 303K | |
| LPOP.pdf | 2020-11-20 13:40 | 123K | |
| LPOP slides.pdf | 2020-11-25 08:45 | 1.4M | |
| LPS.pdf | 2009-07-11 19:17 | 120K | |
| LPS Jan 09.pdf | 2009-01-12 19:26 | 117K | |
| LPS revision.pdf | 2014-04-22 09:47 | 539K | |
| LPS with CLOUT.pdf | 2017-04-10 10:28 | 1.3M | |
| LPS with CLOUT.pptx | 2017-04-10 10:16 | 2.3M | |
| LPworld.zip | 2002-03-09 18:18 | 26K | |
| LogicForProblemSolving.pdf | 2019-10-23 18:28 | 16M | |
| Logical English.pdf | 2020-11-11 18:55 | 3.2M | |
| Logical English at CNL 2021.pdf | 2021-09-11 08:42 | 2.4M | |
| Logical English at CNL2021.pdf | 2021-09-11 08:42 | 2.4M | |
| Logical English for Law and Education .pdf | 2023-04-12 12:11 | 904K | |
| Logical English for Law and Education.pdf | 2022-09-08 12:23 | 157K | |
| Logical English meets Legal English.pdf | 2021-08-14 08:23 | 944K | |
| Logical English on World Logic Day.mp4 | 2021-02-09 15:14 | 546M | |
| Logical English on World Logic Day.pdf | 2021-01-16 12:50 | 838K | |
| Logical_English_Demonstration_for_ICLP.pdf | 2023-05-29 21:22 | 500K | |
| Logic and Smart Contracts.pptx | 2018-10-15 09:28 | 6.3M | |
| Logic for Children.pdf | 2024-04-20 09:44 | 2.1M | |
| MALPS.pdf | 2012-02-27 21:07 | 384K | |
| MI5.pdf | 2015-02-26 13:26 | 1.0M | |
| MI7.pdf | 2015-02-26 13:25 | 1.6M | |
| MITEncy.pdf | 2019-10-29 15:03 | 20K | |
| MITEncy.zip | 2002-03-09 18:41 | 16K | |
| Marseille-Edinburgh.pdf | 2024-09-28 09:32 | 756K | |
| MeaningofLife.html | 2003-10-07 12:27 | 83K | |
| Memo75.pdf | 2019-12-10 15:02 | 6.7M | |
| Modularity.pdf | 2005-04-19 10:03 | 171K | |
| NS.pdf | 2011-12-09 07:33 | 463K | |
| Obligations.pdf | 2017-04-30 10:17 | 1.2M | |
| ProblemsandPromisesalt.pdf | 2023-12-16 09:24 | 9.8M | |
| RAK Story 2015 revised.pdf | 2015-11-14 10:56 | 509K | |
| References.pdf | 2002-04-07 05:28 | 490K | |
| RuleML.pdf | 2012-06-12 13:05 | 538K | |
| Rules.pdf | 2009-08-25 16:02 | 188K | |
| Rules and exceptions.pdf | 2018-07-27 12:15 | 2.8M | |
| Semantic Trees.pdf | 2015-06-09 08:56 | 5.5M | |
| TUF.pdf | 2013-01-25 09:32 | 756K | |
| Teleo ALP.pdf | 2012-01-20 19:02 | 720K | |
| Unified Framework Nov 2013.pptx | 2013-11-21 08:39 | 298K | |
| WUENIC JURASIN.pdf | 2012-06-05 10:03 | 396K | |
| Wason.zip | 2002-03-10 13:55 | 22K | |
| abdsurv.pdf | 2019-10-29 14:09 | 428K | |
| abdsurv.ps.gz | 2000-09-01 16:59 | 114K | |
| abstract-arg96.pdf | 2019-08-15 16:15 | 215K | |
| agents-97.pdf.gz | 2000-09-01 16:59 | 43K | |
| agents.ps.gz | 2000-09-01 16:59 | 39K | |
| airtraffic.pdf | 2017-10-12 10:42 | 948K | |
| aiworld.zip | 2002-03-05 13:20 | 102K | |
| algorithm = logic + control.pdf | 2006-07-10 13:50 | 1.2M | |
| alp-clp-sqo.ps.gz | 2000-09-01 17:04 | 53K | |
| alpdb.pdf | 2011-08-20 09:15 | 481K | |
| arg-def.ps.gz | 2000-09-01 16:59 | 91K | |
| arg-recon.pdf | 2019-10-29 14:26 | 150K | |
| arg-recon.ps.gz | 2000-09-01 16:59 | 40K | |
| arg-transf.pdf | 2019-10-29 12:50 | 222K | |
| arg-transf.ps.gz | 2000-09-01 17:04 | 79K | |
| argpp.pdf | 2003-05-08 14:10 | 249K | |
| argumentation.pdf | 2005-02-07 14:13 | 305K | |
| chap1.zip | 2002-03-10 14:10 | 20K | |
| conditionals.pdf | 2009-12-31 12:30 | 320K | |
| conditionals.ps | 2007-11-28 09:44 | 340K | |
| conflict.pdf | 2022-05-19 09:19 | 270K | |
| conflictresolution.pdf | 2003-05-13 21:32 | 147K | |
| connection graphs.pdf | 2006-07-10 13:52 | 1.6M | |
| database updates.pdf | 2006-07-10 13:53 | 1.6M | |
| directory of logicians.pdf | 2006-06-12 20:23 | 111K | |
| dual process.pdf | 2006-06-12 20:24 | 136K | |
| event calculus.pdf | 2006-07-10 13:53 | 168K | |
| fariba.pdf.gz | 2000-09-01 16:59 | 43K | |
| first-arg.pdf | 2019-10-29 14:37 | 219K | |
| first-arg.ps.gz | 2000-09-01 16:59 | 52K | |
| for-back98.ps.gz | 2000-09-01 16:59 | 59K | |
| iclp95paper.pdf | 2019-10-29 14:17 | 135K | |
| iclp95paper.ps.gz | 2000-09-01 17:00 | 366K | |
| iff.PDF | 2003-03-03 08:13 | 755K | |
| iff.pdf | 2019-10-29 12:56 | 766K | |
| ilps94paper.pdf | 2019-10-29 14:33 | 114K | |
| ilps94paper.ps.gz | 2000-09-01 17:01 | 367K | |
| integrity checking.pdf | 2006-07-10 13:54 | 778K | |
| kowalski-van_emden.pdf | 2006-07-10 13:56 | 638K | |
| law.html | 2003-07-28 12:41 | 210K | |
| law.pdf | 2015-06-09 09:56 | 273K | |
| limitations of logic.pdf | 2006-07-10 13:56 | 625K | |
| logic dead or sleeping.pdf | 2006-07-10 13:57 | 38K | |
| logic model theory.pdf | 2006-07-10 13:57 | 228K | |
| logic programming and specification.pdf | 2024-04-18 13:06 | 1.8M | |
| logic semantc networks.pdf | 2006-07-10 13:58 | 799K | |
| logic without model theory.ps.gz | 2006-07-10 13:58 | 73K | |
| lpmas.pdf | 2006-07-10 10:28 | 157K | |
| lpw.ps.gz | 2000-09-01 17:06 | 25K | |
| mod-survey.pdf | 2019-10-29 14:13 | 475K | |
| mod-survey.ps.gz | 2000-09-01 16:59 | 216K | |
| models.pdf | 2010-02-14 10:21 | 263K | |
| models.ps.gz | 2000-09-01 16:59 | 72K | |
| negation legislation.pdf | 2006-06-29 10:05 | 478K | |
| new-book-summary.pdf | 2006-01-31 15:29 | 222K | |
| newbook.pdf | 2010-11-21 09:44 | 1.8M | |
| newbook June 09.pdf | 2009-06-01 11:41 | 1.0M | |
| objects.html | 2004-02-18 12:30 | 136K | |
| oldChap1.html | 2003-07-24 10:26 | 42K | |
| oldChap2.html | 2003-07-24 10:42 | 62K | |
| oldChap3.html | 2003-07-24 11:25 | 62K | |
| oldChap4.html | 2003-07-24 11:07 | 40K | |
| oldChap5.html | 2003-07-24 11:24 | 48K | |
| open.pdf | 2006-12-18 11:42 | 226K | |
| proc-arg.ps.gz | 2000-09-01 17:05 | 114K | |
| proposal for undergraduate degree.pdf | 2015-11-14 08:35 | 278K | |
| rak.html | 2022-05-19 09:23 | 85K | |
| reconciling.pdf | 2019-09-03 14:26 | 96K | |
| reconciling.ps.gz | 2000-09-01 16:59 | 566K | |
| reduction.pdf | 2019-10-29 12:38 | 289K | |
| satisfiability.pdf | 2017-10-02 11:51 | 415K | |
| sl.pdf | 2006-12-18 11:42 | 2.7M | |
| slp.pdf | 2010-10-05 17:21 | 276K | |
| slp.ps.gz | 2000-09-01 16:59 | 114K | |
| springer Aiello fest.pdf | 2006-06-07 16:54 | 256K | |
| swish.pdf | 2018-04-10 13:22 | 2.7M | |
| synthesis.pdf | 2019-10-29 14:44 | 229K | |
| synthesis.ps.gz | 2000-09-01 17:05 | 41K | |
| the case for equality axioms.pdf | 2021-12-16 19:08 | 1.1M | |
| the early years.pdf | 2006-07-10 13:57 | 699K | |
| transformation.ps.gz | 2000-09-01 16:59 | 55K | |
| unified.pdf | 2019-10-29 14:50 | 181K | |
| unify.ps.gz | 2000-09-01 16:59 | 42K | |
| v4.pdf | 2003-05-12 14:36 | 249K | |
| wlp-97.ps.gz | 2000-09-01 16:59 | 68K | |
| wlp95.ps.gz | 2000-09-01 17:06 | 40K | |
| wuenic.pdf | 2011-01-24 11:38 | 240K | |